C13H19FO2 — CID 114347450
3-ethoxy-1-(4-fluoro-2-methylphenyl)butan-2-ol (PubChem CID 114347450) has the molecular formula C13H19FO2 and a molecular weight of 226.29 g/mol. Its IUPAC name is 3-ethoxy-1-(4-fluoro-2-methylphenyl)butan-2-ol.
| Compound Name | 3-ethoxy-1-(4-fluoro-2-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 114347450 |
| Molecular Formula | C13H19FO2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 3-ethoxy-1-(4-fluoro-2-methylphenyl)butan-2-ol |
| SMILES | CCOC(C)C(O)Cc1ccc(F)cc1C |
| InChI | InChI=1S/C13H19FO2/c1-4-16-10(3)13(15)8-11-5-6-12(14)7-9(11)2/h5-7,10,13,15H,4,8H2,1-3H3 |
| InChIKey | SRBOYUQZAIIDGZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |