C13H11Br2FOS — CID 115788463
2-(4-bromo-2-fluorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)ethanol (PubChem CID 115788463) has the molecular formula C13H11Br2FOS and a molecular weight of 394.10 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)ethanol.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 115788463 |
| Molecular Formula | C13H11Br2FOS |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(5-bromo-4-methylthiophen-2-yl)ethanol |
| SMILES | Cc1cc(C(O)Cc2ccc(Br)cc2F)sc1Br |
| InChI | InChI=1S/C13H11Br2FOS/c1-7-4-12(18-13(7)15)11(17)5-8-2-3-9(14)6-10(8)16/h2-4,6,11,17H,5H2,1H3 |
| InChIKey | DOQARISFQHLRLQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |