C12H20ClNOS — CID 116758497
1-(5-chlorothiophen-2-yl)-3-ethoxy-3-methylpentan-2-amine (PubChem CID 116758497) has the molecular formula C12H20ClNOS and a molecular weight of 261.82 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-ethoxy-3-methylpentan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-ethoxy-3-methylpentan-2-amine |
|---|---|
| PubChem CID | 116758497 |
| Molecular Formula | C12H20ClNOS |
| Molecular Weight | 261.82 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-ethoxy-3-methylpentan-2-amine |
| SMILES | CCOC(C)(CC)C(N)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H20ClNOS/c1-4-12(3,15-5-2)10(14)8-9-6-7-11(13)16-9/h6-7,10H,4-5,8,14H2,1-3H3 |
| InChIKey | VDIBYKLUNXZYBK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |