C14H21BrOS — CID 63461626
2-[(5-bromothiophen-2-yl)methyl]-4-propylcyclohexan-1-ol (PubChem CID 63461626) has the molecular formula C14H21BrOS and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-4-propylcyclohexan-1-ol.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-4-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 63461626 |
| Molecular Formula | C14H21BrOS |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-4-propylcyclohexan-1-ol |
| SMILES | CCCC1CCC(O)C(Cc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C14H21BrOS/c1-2-3-10-4-6-13(16)11(8-10)9-12-5-7-14(15)17-12/h5,7,10-11,13,16H,2-4,6,8-9H2,1H3 |
| InChIKey | PSUQJWOPXGRTBD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |