C12H16BrClS — CID 63461149
2-bromo-5-[(2-chloro-5-methylcyclohexyl)methyl]thiophene (PubChem CID 63461149) has the molecular formula C12H16BrClS and a molecular weight of 307.68 g/mol. Its IUPAC name is 2-bromo-5-[(2-chloro-5-methylcyclohexyl)methyl]thiophene.
| Compound Name | 2-bromo-5-[(2-chloro-5-methylcyclohexyl)methyl]thiophene |
|---|---|
| PubChem CID | 63461149 |
| Molecular Formula | C12H16BrClS |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 2-bromo-5-[(2-chloro-5-methylcyclohexyl)methyl]thiophene |
| SMILES | CC1CCC(Cl)C(Cc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C12H16BrClS/c1-8-2-4-11(14)9(6-8)7-10-3-5-12(13)15-10/h3,5,8-9,11H,2,4,6-7H2,1H3 |
| InChIKey | DJRZGAKFSMRVBW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|