C17H18BrClS — CID 63472734
2-bromo-5-[(2-chloro-5-phenylcyclohexyl)methyl]thiophene (PubChem CID 63472734) has the molecular formula C17H18BrClS and a molecular weight of 369.76 g/mol. Its IUPAC name is 2-bromo-5-[(2-chloro-5-phenylcyclohexyl)methyl]thiophene.
| Compound Name | 2-bromo-5-[(2-chloro-5-phenylcyclohexyl)methyl]thiophene |
|---|---|
| PubChem CID | 63472734 |
| Molecular Formula | C17H18BrClS |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 2-bromo-5-[(2-chloro-5-phenylcyclohexyl)methyl]thiophene |
| SMILES | ClC1CCC(c2ccccc2)CC1Cc1ccc(Br)s1 |
| InChI | InChI=1S/C17H18BrClS/c18-17-9-7-15(20-17)11-14-10-13(6-8-16(14)19)12-4-2-1-3-5-12/h1-5,7,9,13-14,16H,6,8,10-11H2 |
| InChIKey | CAWKEPKDSCGWCA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|