C10H13BrO3S2 — CID 115336371
2-(5-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethanol (PubChem CID 115336371) has the molecular formula C10H13BrO3S2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethanol.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethanol |
|---|---|
| PubChem CID | 115336371 |
| Molecular Formula | C10H13BrO3S2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-(1,1-dioxothiolan-3-yl)ethanol |
| SMILES | O=S1(=O)CCC(C(O)Cc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C10H13BrO3S2/c11-10-2-1-8(15-10)5-9(12)7-3-4-16(13,14)6-7/h1-2,7,9,12H,3-6H2 |
| InChIKey | FNUXYOQVFDLNER-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |