C12H16BrNO3S — CID 59525637
2-(6-bromo-2-pyridinyl)-1-(1,1-dioxothian-4-yl)ethanol (PubChem CID 59525637) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-(6-bromo-2-pyridinyl)-1-(1,1-dioxothian-4-yl)ethanol.
| Compound Name | 2-(6-bromo-2-pyridinyl)-1-(1,1-dioxothian-4-yl)ethanol |
|---|---|
| PubChem CID | 59525637 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-(6-bromo-2-pyridinyl)-1-(1,1-dioxothian-4-yl)ethanol |
| SMILES | O=S1(=O)CCC(C(O)Cc2cccc(Br)n2)CC1 |
| InChI | InChI=1S/C12H16BrNO3S/c13-12-3-1-2-10(14-12)8-11(15)9-4-6-18(16,17)7-5-9/h1-3,9,11,15H,4-8H2 |
| InChIKey | ILHKDXOWSPOCMR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|