C10H13BrN2O2S — CID 58335258
4-[(6-bromo-2-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 58335258) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is 4-[(6-bromo-2-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(6-bromo-2-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 58335258 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 4-[(6-bromo-2-pyridinyl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(Cc2cccc(Br)n2)CC1 |
| InChI | InChI=1S/C10H13BrN2O2S/c11-10-3-1-2-9(12-10)8-13-4-6-16(14,15)7-5-13/h1-3H,4-8H2 |
| InChIKey | BIRIODPLODUCPW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|