C10H14N2O3S — CID 62254620
[6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]methanol (PubChem CID 62254620) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]methanol.
| Compound Name | [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 62254620 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]methanol |
| SMILES | O=S1(=O)CCN(c2cccc(CO)n2)CC1 |
| InChI | InChI=1S/C10H14N2O3S/c13-8-9-2-1-3-10(11-9)12-4-6-16(14,15)7-5-12/h1-3,13H,4-8H2 |
| InChIKey | PPVKBHONSZZFBY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |