C14H21N3O — CID 63150729
[6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-pyridinyl]methanol (PubChem CID 63150729) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is [6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-pyridinyl]methanol.
| Compound Name | [6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 63150729 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | [6-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-pyridinyl]methanol |
| SMILES | OCc1cccc(N2CCCN3CCCC3C2)n1 |
| InChI | InChI=1S/C14H21N3O/c18-11-12-4-1-6-14(15-12)17-9-3-8-16-7-2-5-13(16)10-17/h1,4,6,13,18H,2-3,5,7-11H2 |
| InChIKey | WYUAWFHTOSYKBU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |