C14H20N4S — CID 79935683
6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-2-carbothioamide (PubChem CID 79935683) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-2-carbothioamide.
| Compound Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 79935683 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cccc(N2CCN3CCCCC3C2)n1 |
| InChI | InChI=1S/C14H20N4S/c15-14(19)12-5-3-6-13(16-12)18-9-8-17-7-2-1-4-11(17)10-18/h3,5-6,11H,1-2,4,7-10H2,(H2,15,19) |
| InChIKey | ZXJKZCXNGQQDGA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|