C15H21N3S — CID 64588249
6-(2-cyclopentylpyrrolidin-1-yl)pyridine-2-carbothioamide (PubChem CID 64588249) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 6-(2-cyclopentylpyrrolidin-1-yl)pyridine-2-carbothioamide.
| Compound Name | 6-(2-cyclopentylpyrrolidin-1-yl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 64588249 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 6-(2-cyclopentylpyrrolidin-1-yl)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cccc(N2CCCC2C2CCCC2)n1 |
| InChI | InChI=1S/C15H21N3S/c16-15(19)12-7-3-9-14(17-12)18-10-4-8-13(18)11-5-1-2-6-11/h3,7,9,11,13H,1-2,4-6,8,10H2,(H2,16,19) |
| InChIKey | MSNNVRBDARSMBP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|