C14H19N3S — CID 23335401
1-[2-(dimethylamino)ethyl]-5,7-dimethyl-1,8-naphthyridine-2-thione (PubChem CID 23335401) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-5,7-dimethyl-1,8-naphthyridine-2-thione.
| Compound Name | 1-[2-(dimethylamino)ethyl]-5,7-dimethyl-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 23335401 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-5,7-dimethyl-1,8-naphthyridine-2-thione |
| SMILES | Cc1cc(C)c2ccc(=S)n(CCN(C)C)c2n1 |
| InChI | InChI=1S/C14H19N3S/c1-10-9-11(2)15-14-12(10)5-6-13(18)17(14)8-7-16(3)4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | UNJHMGABGRYFFE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|