C15H12N2S — CID 10562783
7-methyl-2-phenyl-1H-1,8-naphthyridine-4-thione (PubChem CID 10562783) has the molecular formula C15H12N2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 7-methyl-2-phenyl-1H-1,8-naphthyridine-4-thione.
| Compound Name | 7-methyl-2-phenyl-1H-1,8-naphthyridine-4-thione |
|---|---|
| PubChem CID | 10562783 |
| Molecular Formula | C15H12N2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 7-methyl-2-phenyl-1H-1,8-naphthyridine-4-thione |
| SMILES | Cc1ccc2c(=S)cc(-c3ccccc3)[nH]c2n1 |
| InChI | InChI=1S/C15H12N2S/c1-10-7-8-12-14(18)9-13(17-15(12)16-10)11-5-3-2-4-6-11/h2-9H,1H3,(H,16,17,18) |
| InChIKey | VXQCNUDURSVDNV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|