C9H13NO3S2 — CID 112642657
1-(1,1-dioxothiolan-3-yl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 112642657) has the molecular formula C9H13NO3S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 112642657 |
| Molecular Formula | C9H13NO3S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | O=S1(=O)CCC(C(O)Cc2cncs2)C1 |
| InChI | InChI=1S/C9H13NO3S2/c11-9(3-8-4-10-6-14-8)7-1-2-15(12,13)5-7/h4,6-7,9,11H,1-3,5H2 |
| InChIKey | JDKYTIHGOFORAV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |