C6H7NO3S — CID 124595713
(2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid (PubChem CID 124595713) has the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 124595713 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid |
| SMILES | O=C(O)[C@@H](O)Cc1cncs1 |
| InChI | InChI=1S/C6H7NO3S/c8-5(6(9)10)1-4-2-7-3-11-4/h2-3,5,8H,1H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | HOABQHHFWIMUSQ-YFKPBYRVSA-N |
| XLogP | 0.13 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |