(2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid

C6H7NO3S — CID 124595713

IUPAC(2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid
SMILESO=C(O)[C@@H](O)Cc1cncs1
InChIInChI=1S/C6H7NO3S/c8-5(6(9)10)1-4-2-7-3-11-4/h2-3,5,8H,1H2,(H,9,10)/t5-/m0/s1
InChIKeyHOABQHHFWIMUSQ-YFKPBYRVSA-N
MW173.19 g/mol
LogP0.13
Rot. Bonds3

About (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid

(2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid (PubChem CID 124595713) has the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid
PubChem CID124595713
Molecular FormulaC6H7NO3S
Molecular Weight173.19 g/mol
Exact Mass173.01
IUPAC Name(2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid
SMILESO=C(O)[C@@H](O)Cc1cncs1
InChIInChI=1S/C6H7NO3S/c8-5(6(9)10)1-4-2-7-3-11-4/h2-3,5,8H,1H2,(H,9,10)/t5-/m0/s1
InChIKeyHOABQHHFWIMUSQ-YFKPBYRVSA-N
XLogP0.13
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.19
LogP ≤ 50.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid?
The IUPAC name of (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid (CID 124595713) is (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid.
What is the SMILES notation for (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid?
The canonical SMILES for (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid is O=C(O)[C@@H](O)Cc1cncs1.
What is the InChIKey of (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid?
The InChIKey is HOABQHHFWIMUSQ-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H7NO3S/c8-5(6(9)10)1-4-2-7-3-11-4/h2-3,5,8H,1H2,(H,9,10)/t5-/m0/s1.
What are the key properties of (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid?
(2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid has a molecular weight of 173.19 g/mol, XLogP of 0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-hydroxy-3-(1,3-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 124595713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).