C6H7NO2S — CID 45121677
3-(1,3-thiazol-5-yl)propanoic acid (PubChem CID 45121677) has the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. Its IUPAC name is 3-(1,3-thiazol-5-yl)propanoic acid.
| Compound Name | 3-(1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 45121677 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 3-(1,3-thiazol-5-yl)propanoic acid |
| SMILES | O=C(O)CCc1cncs1 |
| InChI | InChI=1S/C6H7NO2S/c8-6(9)2-1-5-3-7-4-10-5/h3-4H,1-2H2,(H,8,9) |
| InChIKey | GHLKHRAWUVKIQA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |