2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid

C9H14N2O2S — CID 66568739

IUPAC2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid
SMILESCC(C)N(CC(=O)O)Cc1cncs1
InChIInChI=1S/C9H14N2O2S/c1-7(2)11(5-9(12)13)4-8-3-10-6-14-8/h3,6-7H,4-5H2,1-2H3,(H,12,13)
InChIKeyDUDBOMSCZZEZOC-UHFFFAOYSA-N
MW214.29 g/mol
LogP1.44
Rot. Bonds5

About 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid

2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid (PubChem CID 66568739) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid
PubChem CID66568739
Molecular FormulaC9H14N2O2S
Molecular Weight214.29 g/mol
Exact Mass214.08
IUPAC Name2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid
SMILESCC(C)N(CC(=O)O)Cc1cncs1
InChIInChI=1S/C9H14N2O2S/c1-7(2)11(5-9(12)13)4-8-3-10-6-14-8/h3,6-7H,4-5H2,1-2H3,(H,12,13)
InChIKeyDUDBOMSCZZEZOC-UHFFFAOYSA-N
XLogP1.44
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.29
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid?
The IUPAC name of 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid (CID 66568739) is 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid.
What is the SMILES notation for 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid?
The canonical SMILES for 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid is CC(C)N(CC(=O)O)Cc1cncs1.
What is the InChIKey of 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid?
The InChIKey is DUDBOMSCZZEZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-7(2)11(5-9(12)13)4-8-3-10-6-14-8/h3,6-7H,4-5H2,1-2H3,(H,12,13).
What are the key properties of 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid?
2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid has a molecular weight of 214.29 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid is sourced from PubChem (CID 66568739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).