C9H14N2O2S — CID 66568739
2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid (PubChem CID 66568739) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid.
| Compound Name | 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 66568739 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-[propan-2-yl(1,3-thiazol-5-ylmethyl)amino]acetic acid |
| SMILES | CC(C)N(CC(=O)O)Cc1cncs1 |
| InChI | InChI=1S/C9H14N2O2S/c1-7(2)11(5-9(12)13)4-8-3-10-6-14-8/h3,6-7H,4-5H2,1-2H3,(H,12,13) |
| InChIKey | DUDBOMSCZZEZOC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |