C8H11N3O3S — CID 104874293
(2R)-2-(1,3-thiazol-5-ylmethylcarbamoylamino)propanoic acid (PubChem CID 104874293) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is (2R)-2-(1,3-thiazol-5-ylmethylcarbamoylamino)propanoic acid.
| Compound Name | (2R)-2-(1,3-thiazol-5-ylmethylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 104874293 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (2R)-2-(1,3-thiazol-5-ylmethylcarbamoylamino)propanoic acid |
| SMILES | C[C@@H](NC(=O)NCc1cncs1)C(=O)O |
| InChI | InChI=1S/C8H11N3O3S/c1-5(7(12)13)11-8(14)10-3-6-2-9-4-15-6/h2,4-5H,3H2,1H3,(H,12,13)(H2,10,11,14)/t5-/m1/s1 |
| InChIKey | QBBWCDRWVWFJBY-RXMQYKEDSA-N |
| XLogP | 0.42 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |