C8H12N2O2S — CID 116658029
propan-2-yl N-(1,3-thiazol-5-ylmethyl)carbamate (PubChem CID 116658029) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is propan-2-yl N-(1,3-thiazol-5-ylmethyl)carbamate.
| Compound Name | propan-2-yl N-(1,3-thiazol-5-ylmethyl)carbamate |
|---|---|
| PubChem CID | 116658029 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | propan-2-yl N-(1,3-thiazol-5-ylmethyl)carbamate |
| SMILES | CC(C)OC(=O)NCc1cncs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6(2)12-8(11)10-4-7-3-9-5-13-7/h3,5-6H,4H2,1-2H3,(H,10,11) |
| InChIKey | PAEFAGADGZXNSQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |