About propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate
propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate (PubChem CID 116654769) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate.
Analyze propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate?
The IUPAC name of propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate (CID 116654769) is propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate.
What is the SMILES notation for propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate?
The canonical SMILES for propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate is Cc1ncc(CNC(=O)OC(C)C)s1.
What is the InChIKey of propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate?
The InChIKey is QOFMMGCDBYIANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-6(2)13-9(12)11-5-8-4-10-7(3)14-8/h4,6H,5H2,1-3H3,(H,11,12).
What are the key properties of propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate?
propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate has a molecular weight of 214.29 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamate is sourced from PubChem (CID 116654769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).