C7H10N2O2S — CID 123862472
1,3-thiazol-5-ylmethyl N-ethylcarbamate (PubChem CID 123862472) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-ethylcarbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 123862472 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1cncs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-9-7(10)11-4-6-3-8-5-12-6/h3,5H,2,4H2,1H3,(H,9,10) |
| InChIKey | ABYMRAIYNYDWOQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |