C11H10N2O2S — CID 86791542
1,3-thiazol-5-ylmethyl 5-methylpyridine-3-carboxylate (PubChem CID 86791542) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl 5-methylpyridine-3-carboxylate.
| Compound Name | 1,3-thiazol-5-ylmethyl 5-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 86791542 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl 5-methylpyridine-3-carboxylate |
| SMILES | Cc1cncc(C(=O)OCc2cncs2)c1 |
| InChI | InChI=1S/C11H10N2O2S/c1-8-2-9(4-12-3-8)11(14)15-6-10-5-13-7-16-10/h2-5,7H,6H2,1H3 |
| InChIKey | JLKQSQYKOWCKFL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |