C13H11FN2O3S — CID 75518259
1,3-thiazol-5-ylmethyl 3-acetamido-4-fluorobenzoate (PubChem CID 75518259) has the molecular formula C13H11FN2O3S and a molecular weight of 294.31 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl 3-acetamido-4-fluorobenzoate.
| Compound Name | 1,3-thiazol-5-ylmethyl 3-acetamido-4-fluorobenzoate |
|---|---|
| PubChem CID | 75518259 |
| Molecular Formula | C13H11FN2O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl 3-acetamido-4-fluorobenzoate |
| SMILES | CC(=O)Nc1cc(C(=O)OCc2cncs2)ccc1F |
| InChI | InChI=1S/C13H11FN2O3S/c1-8(17)16-12-4-9(2-3-11(12)14)13(18)19-6-10-5-15-7-20-10/h2-5,7H,6H2,1H3,(H,16,17) |
| InChIKey | XOLMNIYVPDTBKX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |