C15H15FN4O5 — CID 47585429
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-acetamido-4-fluorobenzoate (PubChem CID 47585429) has the molecular formula C15H15FN4O5 and a molecular weight of 350.31 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-acetamido-4-fluorobenzoate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-acetamido-4-fluorobenzoate |
|---|---|
| PubChem CID | 47585429 |
| Molecular Formula | C15H15FN4O5 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-acetamido-4-fluorobenzoate |
| SMILES | CC(=O)Nc1cc(C(=O)OCCn2c([N+](=O)[O-])cnc2C)ccc1F |
| InChI | InChI=1S/C15H15FN4O5/c1-9-17-8-14(20(23)24)19(9)5-6-25-15(22)11-3-4-12(16)13(7-11)18-10(2)21/h3-4,7-8H,5-6H2,1-2H3,(H,18,21) |
| InChIKey | JPFHZPSHOBIFAI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|