C14H14ClN3O4 — CID 165350326
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(chloromethyl)benzoate (PubChem CID 165350326) has the molecular formula C14H14ClN3O4 and a molecular weight of 323.74 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(chloromethyl)benzoate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(chloromethyl)benzoate |
|---|---|
| PubChem CID | 165350326 |
| Molecular Formula | C14H14ClN3O4 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(chloromethyl)benzoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C14H14ClN3O4/c1-10-16-9-13(18(20)21)17(10)5-6-22-14(19)12-4-2-3-11(7-12)8-15/h2-4,7,9H,5-6,8H2,1H3 |
| InChIKey | LDLHLZQDBQATOV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|