C13H11Cl2N3O4 — CID 60592163
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3,5-dichlorobenzoate (PubChem CID 60592163) has the molecular formula C13H11Cl2N3O4 and a molecular weight of 344.15 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3,5-dichlorobenzoate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 60592163 |
| Molecular Formula | C13H11Cl2N3O4 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3,5-dichlorobenzoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2N3O4/c1-8-16-7-12(18(20)21)17(8)2-3-22-13(19)9-4-10(14)6-11(15)5-9/h4-7H,2-3H2,1H3 |
| InChIKey | KTGSLDQCXGUVMA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|