About 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate (PubChem CID 60592110) has the molecular formula C17H21N3O4
and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate |
| PubChem CID | 60592110 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H21N3O4/c1-12-18-11-15(20(22)23)19(12)9-10-24-16(21)13-5-7-14(8-6-13)17(2,3)4/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | QSYOTMTVYGEAOQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate (CID 60592110) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate is Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate?
The InChIKey is QSYOTMTVYGEAOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O4/c1-12-18-11-15(20(22)23)19(12)9-10-24-16(21)13-5-7-14(8-6-13)17(2,3)4/h5-8,11H,9-10H2,1-4H3.
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate?
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate has a molecular weight of 331.37 g/mol, XLogP of 3.25, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-tert-butylbenzoate is sourced from PubChem (CID 60592110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).