About 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate (PubChem CID 143197186) has the molecular formula C9H13N3O5S
and a molecular weight of 275.29 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate |
| PubChem CID | 143197186 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)OCCS |
| InChI | InChI=1S/C9H13N3O5S/c1-7-10-6-8(12(14)15)11(7)2-3-16-9(13)17-4-5-18/h6,18H,2-5H2,1H3 |
| InChIKey | ZANNADPAOHGKDT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate (CID 143197186) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate is Cc1ncc([N+](=O)[O-])n1CCOC(=O)OCCS.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate?
The InChIKey is ZANNADPAOHGKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O5S/c1-7-10-6-8(12(14)15)11(7)2-3-16-9(13)17-4-5-18/h6,18H,2-5H2,1H3.
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate?
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate has a molecular weight of 275.29 g/mol, XLogP of 1.18, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-sulfanylethyl carbonate is sourced from PubChem (CID 143197186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).