C13H14N4O6 — CID 171853857
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 171853857) has the molecular formula C13H14N4O6 and a molecular weight of 322.28 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(2,5-dioxopyrrol-1-yl)propanoate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(2,5-dioxopyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 171853857 |
| Molecular Formula | C13H14N4O6 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H14N4O6/c1-9-14-8-10(17(21)22)15(9)6-7-23-13(20)4-5-16-11(18)2-3-12(16)19/h2-3,8H,4-7H2,1H3 |
| InChIKey | VMMLCRLRTUAODX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 124.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|