C21H29N9O10 — CID 87758433
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[2-[4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobutanoyl]hydrazinyl]methylamino]-4-oxobutanoate (PubChem CID 87758433) has the molecular formula C21H29N9O10 and a molecular weight of 567.52 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[2-[4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobutanoyl]hydrazinyl]methylamino]-4-oxobutanoate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[2-[4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobutanoyl]hydrazinyl]methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 87758433 |
| Molecular Formula | C21H29N9O10 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-[[2-[4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobutanoyl]hydrazinyl]methylamino]-4-oxobutanoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)CCC(=O)NCNNC(=O)CCC(=O)OCCn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C21H29N9O10/c1-14-22-11-18(29(35)36)27(14)7-9-39-20(33)5-3-16(31)24-13-25-26-17(32)4-6-21(34)40-10-8-28-15(2)23-12-19(28)30(37)38/h11-12,25H,3-10,13H2,1-2H3,(H,24,31)(H,26,32) |
| InChIKey | NQDYJQKQEBWQTO-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 244.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|