C10H11N3O6 — CID 16645655
(Z)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobut-2-enoic acid (PubChem CID 16645655) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is (Z)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 16645655 |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (Z)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-4-oxobut-2-enoic acid |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C10H11N3O6/c1-7-11-6-8(13(17)18)12(7)4-5-19-10(16)3-2-9(14)15/h2-3,6H,4-5H2,1H3,(H,14,15)/b3-2- |
| InChIKey | BZTICTOXFPBZSX-IHWYPQMZSA-N |
| XLogP | 0.28 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|