About 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate (PubChem CID 10542447) has the molecular formula C14H13N3O5
and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate |
| PubChem CID | 10542447 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H13N3O5/c1-10-15-8-13(17(20)21)16(10)6-7-22-14(19)12-4-2-11(9-18)3-5-12/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | MZLGXNVDVXYCHK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate (CID 10542447) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate is Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc(C=O)cc1.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate?
The InChIKey is MZLGXNVDVXYCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O5/c1-10-15-8-13(17(20)21)16(10)6-7-22-14(19)12-4-2-11(9-18)3-5-12/h2-5,8-9H,6-7H2,1H3.
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate?
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate has a molecular weight of 303.27 g/mol, XLogP of 1.77, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 4-formylbenzoate is sourced from PubChem (CID 10542447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).