C32H32N6O10 — CID 139062930
benzene-1,3-diol;bis(2-(2-methyl-5-nitroimidazol-1-yl)ethyl benzoate) (PubChem CID 139062930) has the molecular formula C32H32N6O10 and a molecular weight of 660.64 g/mol. Its IUPAC name is benzene-1,3-diol;bis(2-(2-methyl-5-nitroimidazol-1-yl)ethyl benzoate).
| Compound Name | benzene-1,3-diol;bis(2-(2-methyl-5-nitroimidazol-1-yl)ethyl benzoate) |
|---|---|
| PubChem CID | 139062930 |
| Molecular Formula | C32H32N6O10 |
| Molecular Weight | 660.64 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | benzene-1,3-diol;bis(2-(2-methyl-5-nitroimidazol-1-yl)ethyl benzoate) |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccccc1.Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccccc1.Oc1cccc(O)c1 |
| InChI | InChI=1S/2C13H13N3O4.C6H6O2/c2*1-10-14-9-12(16(18)19)15(10)7-8-20-13(17)11-5-3-2-4-6-11;7-5-2-1-3-6(8)4-5/h2*2-6,9H,7-8H2,1H3;1-4,7-8H |
| InChIKey | SACVMJKRTURRRS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 214.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|