About 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate
2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate (PubChem CID 13339446) has the molecular formula C8H10ClN3O4
and a molecular weight of 247.63 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-chloroacetate.
Molecular Properties
| Compound Name | 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate |
| PubChem CID | 13339446 |
| Molecular Formula | C8H10ClN3O4 |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-chloroacetate |
| SMILES | CC1=NC=C(N1CCOC(=O)CCl)[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClN3O4/c1-6-10-5-7(12(14)15)11(6)2-3-16-8(13)4-9/h5H,2-4H2,1H3 |
| InChIKey | PCKNGIOWRPKVEF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | 270 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate?
The IUPAC name of 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate (CID 13339446) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-chloroacetate.
What is the SMILES notation for 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate?
The canonical SMILES for 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate is CC1=NC=C(N1CCOC(=O)CCl)[N+](=O)[O-].
What is the InChIKey of 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate?
The InChIKey is PCKNGIOWRPKVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3O4/c1-6-10-5-7(12(14)15)11(6)2-3-16-8(13)4-9/h5H,2-4H2,1H3.
What are the key properties of 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate?
2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate has a molecular weight of 247.63 g/mol, XLogP of 0.90, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl chloroacetate is sourced from PubChem (CID 13339446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).