C11H16N6O6 — CID 11278866
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-(diaminomethylideneamino)-2-oxoethoxy]acetate (PubChem CID 11278866) has the molecular formula C11H16N6O6 and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-(diaminomethylideneamino)-2-oxoethoxy]acetate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-(diaminomethylideneamino)-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 11278866 |
| Molecular Formula | C11H16N6O6 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[2-(diaminomethylideneamino)-2-oxoethoxy]acetate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)COCC(=O)N=C(N)N |
| InChI | InChI=1S/C11H16N6O6/c1-7-14-4-9(17(20)21)16(7)2-3-23-10(19)6-22-5-8(18)15-11(12)13/h4H,2-3,5-6H2,1H3,(H4,12,13,15,18) |
| InChIKey | VIEHXBLTYGYATB-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 177.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|