C8H13N7O2S — CID 83083017
2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083017) has the molecular formula C8H13N7O2S and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083017 |
| Molecular Formula | C8H13N7O2S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCCn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C8H13N7O2S/c1-5-12-4-6(15(16)17)14(5)2-3-18-8(11)13-7(9)10/h4H,2-3H2,1H3,(H5,9,10,11,13) |
| InChIKey | CKDUMWDEIRFENH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|