C7H9N3O6-2 — CID 68777643
2-(2-methyl-5-nitroimidazol-1-yl)ethanol carbonate (PubChem CID 68777643) has the molecular formula C7H9N3O6-2 and a molecular weight of 231.16 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethanol carbonate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol carbonate |
|---|---|
| PubChem CID | 68777643 |
| Molecular Formula | C7H9N3O6-2 |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol carbonate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCO.O=C([O-])[O-] |
| InChI | InChI=1S/C6H9N3O3.CH2O3/c1-5-7-4-6(9(11)12)8(5)2-3-10;2-1(3)4/h4,10H,2-3H2,1H3;(H2,2,3,4)/p-2 |
| InChIKey | DFSJBYGLDVIWSX-UHFFFAOYSA-L |
| XLogP | -2.35 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|