C14H21N4O8P — CID 174870539
2-(2-methyl-5-nitroimidazol-1-yl)ethanol;N-phenylacetamide;phosphoric acid (PubChem CID 174870539) has the molecular formula C14H21N4O8P and a molecular weight of 404.32 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;N-phenylacetamide;phosphoric acid.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;N-phenylacetamide;phosphoric acid |
|---|---|
| PubChem CID | 174870539 |
| Molecular Formula | C14H21N4O8P |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;N-phenylacetamide;phosphoric acid |
| SMILES | CC(=O)Nc1ccccc1.Cc1ncc([N+](=O)[O-])n1CCO.O=P(O)(O)O |
| InChI | InChI=1S/C8H9NO.C6H9N3O3.H3O4P/c1-7(10)9-8-5-3-2-4-6-8;1-5-7-4-6(9(11)12)8(5)2-3-10;1-5(2,3)4/h2-6H,1H3,(H,9,10);4,10H,2-3H2,1H3;(H3,1,2,3,4) |
| InChIKey | VKDXENVFXWFFED-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 188.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|