C7H11N3O3 — CID 71752371
1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol (PubChem CID 71752371) has the molecular formula C7H11N3O3 and a molecular weight of 191.22 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol.
| Compound Name | 1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 71752371 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol |
| SMILES | [2H]C([2H])(O)C([2H])([2H])C([2H])([2H])n1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C7H11N3O3/c1-6-8-5-7(10(12)13)9(6)3-2-4-11/h5,11H,2-4H2,1H3/i2D2,3D2,4D2 |
| InChIKey | DUOHVNSMLSPTMI-PWDWWLAZSA-N |
| XLogP | 0.48 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|