About 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene
2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene (PubChem CID 134326780) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene |
| PubChem CID | 134326780 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCO.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H9N3O3/c1-2-6-10-8-4-3-7-9(10)5-1;1-5-7-4-6(9(11)12)8(5)2-3-10/h1-8H;4,10H,2-3H2,1H3 |
| InChIKey | ASZRUOZSQUJBAZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene (CID 134326780) is 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene is Cc1ncc([N+](=O)[O-])n1CCO.c1ccc2ccccc2c1.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene?
The InChIKey is ASZRUOZSQUJBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C6H9N3O3/c1-2-6-10-8-4-3-7-9(10)5-1;1-5-7-4-6(9(11)12)8(5)2-3-10/h1-8H;4,10H,2-3H2,1H3.
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene?
2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene has a molecular weight of 299.33 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethanol;naphthalene is sourced from PubChem (CID 134326780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).