About 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate (PubChem CID 141294627) has the molecular formula C9H12BrN3O4
and a molecular weight of 306.12 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate |
| PubChem CID | 141294627 |
| Molecular Formula | C9H12BrN3O4 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)C(C)Br |
| InChI | InChI=1S/C9H12BrN3O4/c1-6(10)9(14)17-4-3-12-7(2)11-5-8(12)13(15)16/h5-6H,3-4H2,1-2H3 |
| InChIKey | YXQZNLFEKRXXMG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate (CID 141294627) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate is Cc1ncc([N+](=O)[O-])n1CCOC(=O)C(C)Br.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate?
The InChIKey is YXQZNLFEKRXXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN3O4/c1-6(10)9(14)17-4-3-12-7(2)11-5-8(12)13(15)16/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate?
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate has a molecular weight of 306.12 g/mol, XLogP of 1.43, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-bromopropanoate is sourced from PubChem (CID 141294627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).