C16H28ClN5O7S2 — CID 54591176
2-[2-[2-(dimethylamino)ethylcarbamoyloxy]ethyldisulfanyl]ethyl 2-(2-methyl-5-nitroimidazol-1-yl)ethyl carbonate;hydrochloride (PubChem CID 54591176) has the molecular formula C16H28ClN5O7S2 and a molecular weight of 502.02 g/mol. Its IUPAC name is 2-[2-[2-(dimethylamino)ethylcarbamoyloxy]ethyldisulfanyl]ethyl 2-(2-methyl-5-nitroimidazol-1-yl)ethyl carbonate;hydrochloride.
| Compound Name | 2-[2-[2-(dimethylamino)ethylcarbamoyloxy]ethyldisulfanyl]ethyl 2-(2-methyl-5-nitroimidazol-1-yl)ethyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 54591176 |
| Molecular Formula | C16H28ClN5O7S2 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-[2-[2-(dimethylamino)ethylcarbamoyloxy]ethyldisulfanyl]ethyl 2-(2-methyl-5-nitroimidazol-1-yl)ethyl carbonate;hydrochloride |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)OCCSSCCOC(=O)NCCN(C)C.Cl |
| InChI | InChI=1S/C16H27N5O7S2.ClH/c1-13-18-12-14(21(24)25)20(13)6-7-27-16(23)28-9-11-30-29-10-8-26-15(22)17-4-5-19(2)3;/h12H,4-11H2,1-3H3,(H,17,22);1H |
| InChIKey | RAGNRTPEJVKLFP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|