C11H17Cl3N5O4+ — CID 7032680
dimethyl-[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]azanium (PubChem CID 7032680) has the molecular formula C11H17Cl3N5O4+ and a molecular weight of 389.65 g/mol. Its IUPAC name is dimethyl-[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]azanium.
| Compound Name | dimethyl-[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]azanium |
|---|---|
| PubChem CID | 7032680 |
| Molecular Formula | C11H17Cl3N5O4+ |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | dimethyl-[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]azanium |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)N[C@@H]([NH+](C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3N5O4/c1-7-15-6-8(19(21)22)18(7)4-5-23-10(20)16-9(17(2)3)11(12,13)14/h6,9H,4-5H2,1-3H3,(H,16,20)/p+1/t9-/m0/s1 |
| InChIKey | YONGJIFOGUEUNJ-VIFPVBQESA-O |
| XLogP | 0.67 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|