C17H18Cl3N5O6 — CID 40614938
methyl 4-[[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]amino]benzoate (PubChem CID 40614938) has the molecular formula C17H18Cl3N5O6 and a molecular weight of 494.72 g/mol. Its IUPAC name is methyl 4-[[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]amino]benzoate.
| Compound Name | methyl 4-[[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]amino]benzoate |
|---|---|
| PubChem CID | 40614938 |
| Molecular Formula | C17H18Cl3N5O6 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | methyl 4-[[(1S)-2,2,2-trichloro-1-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxycarbonylamino]ethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N[C@@H](NC(=O)OCCn2c([N+](=O)[O-])cnc2C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H18Cl3N5O6/c1-10-21-9-13(25(28)29)24(10)7-8-31-16(27)23-15(17(18,19)20)22-12-5-3-11(4-6-12)14(26)30-2/h3-6,9,15,22H,7-8H2,1-2H3,(H,23,27)/t15-/m0/s1 |
| InChIKey | SFAWUJYELZHFNW-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 137.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|