C14H15Cl3N6O4 — CID 7000432
2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate (PubChem CID 7000432) has the molecular formula C14H15Cl3N6O4 and a molecular weight of 437.67 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 7000432 |
| Molecular Formula | C14H15Cl3N6O4 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)N[C@H](Nc1ccccn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H15Cl3N6O4/c1-9-19-8-11(23(25)26)22(9)6-7-27-13(24)21-12(14(15,16)17)20-10-4-2-3-5-18-10/h2-5,8,12H,6-7H2,1H3,(H,18,20)(H,21,24)/t12-/m0/s1 |
| InChIKey | RNAQFUZWUHGIFW-LBPRGKRZSA-N |
| XLogP | 3.03 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|