C13H13Cl3F2N8O4 — CID 166632360
2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(2-amino-4,6-dichloropyrimidin-5-yl)amino]-2-chloro-2,2-difluoroethyl]carbamate (PubChem CID 166632360) has the molecular formula C13H13Cl3F2N8O4 and a molecular weight of 489.65 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(2-amino-4,6-dichloropyrimidin-5-yl)amino]-2-chloro-2,2-difluoroethyl]carbamate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(2-amino-4,6-dichloropyrimidin-5-yl)amino]-2-chloro-2,2-difluoroethyl]carbamate |
|---|---|
| PubChem CID | 166632360 |
| Molecular Formula | C13H13Cl3F2N8O4 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(2-amino-4,6-dichloropyrimidin-5-yl)amino]-2-chloro-2,2-difluoroethyl]carbamate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)NC(Nc1c(Cl)nc(N)nc1Cl)C(F)(F)Cl |
| InChI | InChI=1S/C13H13Cl3F2N8O4/c1-5-20-4-6(26(28)29)25(5)2-3-30-12(27)24-10(13(16,17)18)21-7-8(14)22-11(19)23-9(7)15/h4,10,21H,2-3H2,1H3,(H,24,27)(H2,19,22,23) |
| InChIKey | DMEQTSXRZLBWFE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|