C20H18N2O3S — CID 86826393
(2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamido-4-methylbenzoate (PubChem CID 86826393) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamido-4-methylbenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamido-4-methylbenzoate |
|---|---|
| PubChem CID | 86826393 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2-phenyl-1,3-thiazol-5-yl)methyl 3-acetamido-4-methylbenzoate |
| SMILES | CC(=O)Nc1cc(C(=O)OCc2cnc(-c3ccccc3)s2)ccc1C |
| InChI | InChI=1S/C20H18N2O3S/c1-13-8-9-16(10-18(13)22-14(2)23)20(24)25-12-17-11-21-19(26-17)15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | SXHUONHHRIQJEE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |