C18H15N3O3S — CID 78765064
(2-phenyl-1,3-thiazol-5-yl)methyl 4-(carbamoylamino)benzoate (PubChem CID 78765064) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-5-yl)methyl 4-(carbamoylamino)benzoate.
| Compound Name | (2-phenyl-1,3-thiazol-5-yl)methyl 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 78765064 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (2-phenyl-1,3-thiazol-5-yl)methyl 4-(carbamoylamino)benzoate |
| SMILES | NC(=O)Nc1ccc(C(=O)OCc2cnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C18H15N3O3S/c19-18(23)21-14-8-6-13(7-9-14)17(22)24-11-15-10-20-16(25-15)12-4-2-1-3-5-12/h1-10H,11H2,(H3,19,21,23) |
| InChIKey | DLSDYXWTWXUGMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |